To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 845272-21-1 |
| Chemical Name: | Varlitinib |
| Synonyms: | ARRY-334543，ARRY 334543，ARRY334543 |
| SMILES: | N1=C2C(C=C(NC3=N[C@@H](C)CO3)C=C2)=C(NC2=CC=C(OCC3=NC=CS3)C(Cl)=C2)N=C1 |
| Formula: | C22H19ClN6O2S |
| M.Wt: | 466.94 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | ARRY334543 is a potent and selective ATP-competitive inhibitor that blocks the phosphorylation of EGFR and subsequently blocks signal transduction from the receptor site. ARRY334543 is effective against a variety of cancer cell lines including A431. |