| Cas No.: | 2863686-82-0 |
| Chemical Name: | SPEN-IN-1 |
| Synonyms: | Cmopound X1 |
| SMILES: | C1=CC=CC=C1COC1=CC(C2=CC=C3NN=C(C4=NC5C=CC=CC=5N4)C3=C2)=CC=C1 |
| Formula: | C27H20N4O |
| M.Wt: | 416.47 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Publication: | Targeting Xist with compounds that disrupt RNA structure and X inactivation--Nature,2022-Mar-30 |
| Description: | Compound X1 (Xist) X1 (Xist) binds the non-coding RNA prototype Xist, specifically the RepA motif, with Kd of 0.4 μM. X1 binding reduces the conformational space of RepA, displaces cognate interacting protein factors (PRC2 and SPEN), suppresses histone H3K27 trimethylation, and blocks initiation of X-chromosome inactivation. |
| References: | Rodrigo Aguilar et al. Targeting Xist with compounds that disrupt RNA structure and X inactivation. Nature, 2022, doi:10.1038/s41586-022-04537-z. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
