| Cas No.: | 75520-41-1 |
| Chemical Name: | Acetyl coenzyme A trilithium |
| SMILES: | O[C@H]1[C@@H](O[C@H](COP(OP(OCC(C)([C@H](O)C(NCCC(NCCSC(C)=O)=O)=O)C)(O[Li])=O)(O[Li])=O)[C@H]1OP(O)(O[Li])=O)N2C3=C(C(N)=NC=N3)N=C2 |
| Formula: | C23H35Li3N7O17P3S |
| M.Wt: | 827.37 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
