| Cas No.: | 2227211-00-7 |
| Chemical Name: | US10793575, Example 23 |
| Synonyms: | BDBM465748;US10793575, Example 23;2-(3-{2-amino-6-[1-(oxetan-3-yl)-1,2,3,6-tetrahydropyridin-4-yl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl}-2-(hydroxymethyl)phenyl)-6-cyclopropyl-8-fluoroisoquinolin-1(2H)-one |
| SMILES: | FC1=C2C(N(C3=C([H])C([H])=C([H])C(=C3C([H])([H])O[H])C3=C4C(=NC(N([H])[H])=N3)N([H])C(=C4[H])C3=C([H])C([H])([H])N(C([H])([H])C3([H])[H])C3([H])C([H])([H])OC3([H])[H])C([H])=C([H])C2=C([H])C(=C1[H])C1([H])C([H])([H])C1([H])[H])=O |
| Formula: | C33H31FN6O3 |
| M.Wt: | 578.6361 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
