| Cas No.: | 136207-23-3 |
| Chemical Name: | L-Leucine, 2,3,4,5,6-pentafluoro-D-phenylalanyl-L-glutaminyl-L-tryptophyl-L-alanyl-L-valyl-D-alanyl-L-histidyl-, methyl ester |
| Synonyms: | L-Leucine, 2,3,4,5,6-pentafluoro-D-phenylalanyl-L-glutaminyl-L-tryptophyl-L-alanyl-L-valyl-D-alanyl-L-histidyl-, methyl ester;BIM-26226 |
| SMILES: | C(OC)(=O)[C@H](CC(C)C)NC(=O)[C@H](CC1N=CNC=1)NC(=O)[C@@H](C)NC(=O)[C@H](C(C)C)NC(=O)[C@H](C)NC(=O)[C@H](CC1C2=C(C=CC=C2)NC=1)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](CC1=C(F)C(F)=C(F)C(F)=C1F)N |
| Formula: | C49H63F5N12O10 |
| M.Wt: | 1075.09094834328 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
.gif)