| Cas No.: | 1441057-15-3 |
| Chemical Name: | BMS-963272 |
| Synonyms: | 2(1H)-Pyridinone, 5,6-dihydro-4-(4-methylphenyl)-3-(2H-tetrazol-5-yl)-6-[4-(4,4,4-trifluorobutoxy)phenyl]-6-(trifluoromethyl)-, (6S)-;BMS-963272 |
| SMILES: | C1(=O)N[C@@](C2=CC=C(OCCCC(F)(F)F)C=C2)(C(F)(F)F)CC(C2=CC=C(C)C=C2)=C1C1=NNN=N1 |
| Formula: | C24H21F6N5O2 |
| M.Wt: | 525.446265935898 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
