| Cas No.: | 1615208-41-7 |
| Chemical Name: | 1H-Pyrazole-3-carboxylic acid, 5-[[3-[(S)-[[[(3R)-1-azabicyclo[2.2.2]oct-3-yloxy]carbonyl]amino]phenylmethyl]phenoxy]methyl]-1-methyl-, 4-[[(2R)-2-(1,2-dihydro-8-hydroxy-2-oxo-5-quinolinyl)-2-hydroxyethyl]amino]butyl ester |
| SMILES: | [C@H](C1C=CC(O)=C2NC(=O)C=CC=12)(O)CNCCCCOC(C1=NN(C)C(COC2C=CC=C([C@H](C3C=CC=CC=3)NC(=O)O[C@H]3CN4CCC3CC4)C=2)=C1)=O |
| Formula: | C42H48N6O8 |
| M.Wt: | 764.87 |
| Purity: | 98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
