| Cas No.: | 2408824-56-4 |
| Chemical Name: | CLC-2-IN-AK42 |
| Synonyms: | CLC-2-IN-AK42;2-[[2,6-Dichloro-3-(phenylmethoxy)phenyl]amino]-3-pyridinecarboxylic acid |
| SMILES: | C1C=C(Cl)C(NC2N=CC=CC=2C(O)=O)=C(Cl)C=1OCC1C=CC=CC=1 |
| Formula: | C19H14Cl2N2O3 |
| M.Wt: | 389.23206281662 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
