| Cas No.: | 1609-47-8 |
| Chemical Name: | Diethyl pyrocarbonate |
| Synonyms: | Diethyl pyrocarbonate;Diethyl oxydiformate;Ethoxyformic anhydride;Pyrocarbonic acid diethyl ester;Diethyl dicarbonate;dicarbonicaciddiethylester;Diethyl ester of pyrocarbonic acid;Diethyl pyrocarbonic acid;Diethylester kyseliny diuhlicite;DEPC;DIETHYLPYROCARBONATE (DEPC);DEP,DEPC,Diethyl dicarbonate;ethoxycarbonyl ethyl carbonate;Ethoxyformic acid anhydride;DEP;Baycovin;Ethyl pyrocarbonate;Diethylpyrocarbonate;Dicarbonic acid, diethyl ester;Dicarbonic acid diethyl ester;Piref;Diethylpyrokarbonat;Oxydiformic acid diethyl ester;Pyrocarbonate d'ethyle;Pyrokohlensaeure diaethyl ester;Pyrocarbonic acid, diethyl ester |
| SMILES: | O(C(=O)OC(=O)OC([H])([H])C([H])([H])[H])C([H])([H])C([H])([H])[H] |
| Formula: | C6H10O5 |
| M.Wt: | 162.1406 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Diethyl pyrocarbonate is a potent, non-specific inhibitor of RNase. It has been useful as an in vitro agent, relatively specific for binding to imidazole of histidine. It inhibits central chemosensitivity in rabbit and can modify Ser, Thr, His and Tyr residues. |
| References: | [1]. E E Nattie. Diethyl pyrocarbonate (an imidazole binding substance) inhibits rostral VLM CO2 sensitivity. J Appl Physiol (1985). 1986 Sep;61(3):843-50. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
