| Cas No.: | 134036-52-5 |
| Chemical Name: | (E)-N-Benzyl-2-cyano-3-(3,4-dihydroxyphenyl)acrylamide |
| Synonyms: | (E)-N-Benzyl-2-cyano-3-(3,4-dihydroxyphenyl)acrylamide;AG 490;2-Propenamide,2-cyano-3-(3,4-dihydroxyphenyl)-N-(phenylmethyl)-;AG-490;TYRPHOSTIN AG 490;Tyrphostin B 42;(E/Z)-AG490 |
| SMILES: | C(NC(=O)/C(/C#N)=C/C1C=CC(O)=C(O)C=1)C1C=CC=CC=1 |
| Formula: | C17H14N2O3 |
| M.Wt: | 294.30466 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
