| Cas No.: | 870964-67-3 |
| Chemical Name: | Evocalcet |
| Synonyms: | Evocalcet;E58MLH082P;2-(4-((S)-3-(((R)-1-(naphthalen-1-yl)ethyl)amino)pyrrolidin-1-yl)phenyl)acetic acid;2-[4-[(3S)-3-[[(1R)-1-naphthalen-1-ylethyl]amino]pyrrolidin-1-yl]phenyl]acetic acid;Evocalcet [INN];2-[4-[(3S)-3-[[(1R)-1-naphthalen-1-ylethyl]amino]pyrrolidin-1-yl]phenyl]ethanoic acid;H43;Orkedia (TN);Evocalcet (JAN/INN);GTPL9042;KHK7580;DB12388;SB18696;Benzeneacetic acid, 4-((3S)-3-(((1R)-1-(1-naphthalenyl)ethyl)ami |
| SMILES: | OC(CC1C=CC(=CC=1)N1CC[C@@H](C1)N[C@H](C)C1=CC=CC2C=CC=CC1=2)=O |
| Formula: | C24H26N2O2 |
| M.Wt: | 374.475446224213 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
