| Cas No.: | 1127442-87-8 |
| Chemical Name: | exo-IWR-1 |
| Synonyms: | exo-IWR-1;exo-IWR 1;IWR-1 exo (IWR-1-exo, exo IWR-1);IWR-1-exo;4-[(3aR,4R,7S,7aS-rel)-1,3,3a,4,7,7a-Hexahydro-1,3-dioxo-4,7-Methano-2H-isoindol-2-yl]-N-8-quinolinylbenzaMide |
| SMILES: | C1=CC2=C(C(=C1)NC(=O)C3=CC=C(C=C3)N4C(=O)[C@@H]5[C@H]6C=C[C@H](C6)[C@@H]5C4=O)N=CC=C2 |
| Formula: | C25H19N3O3 |
| M.Wt: | 409.43700 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
