| Cas No.: | 2410512-38-6 |
| Chemical Name: | JQKD-82 |
| Synonyms: | 4-Pyridinecarboxylic acid, 2-[[[2-[[2-(dimethylamino)ethyl]ethylamino]-2-oxoethyl]amino]methyl]-, 2,4-bis(1-methylethoxy)phenyl ester;JQKD82 |
| SMILES: | C1C=NC(=CC=1C(OC1C=CC(OC(C)C)=CC=1OC(C)C)=O)CNCC(N(CC)CCN(C)C)=O |
| Formula: | C27H40N4O5 |
| M.Wt: | 500.63 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
