To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 2089130-74-3 |
| Chemical Name: | Benzoic acid, 4-[(1R,2S)-1-(4-cyclopropylphenyl)-2-[[[(2R)-tetrahydro-2-furanyl]carbonyl]amino]propoxy]-, (3S)-1-[[(3R)-tetrahydro-5-oxo-3-furanyl]carbonyl]-3-piperidinyl ester |
| SMILES: | C1CC1C1C=CC(C([C@H](C)NC(=O)[C@H]2CCCO2)OC2C=CC(C(O[C@@H]3CN(C(=O)[C@H]4COC(C4)=O)CCC3)=O)=CC=2)=CC=1 |
| Formula: | C34H40N2O8 |
| M.Wt: | 604.69 |
| Purity: | 98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
