To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 1600418-29-8 |
| Chemical Name: | MC-GGFG-Exatecan |
| Synonyms: | MC-Ggfg-DX8951;Trastuzumab Impurity 1;BCP31889;MC-GGFG-Exatecan |
| SMILES: | FC1C([H])=C2C3=C(C=1C([H])([H])[H])C([H])([H])C([H])([H])[C@@]([H])(C3=C1C(C3=C([H])C4[C@](C(=O)OC([H])([H])C=4C(N3C1([H])[H])=O)(C([H])([H])C([H])([H])[H])O[H])=N2)N([H])C(C([H])([H])N([H])C([C@]([H])(C([H])([H])C1C([H])=C([H])C([H])=C([H])C=1[H])N([H])C(C([H])([H])N([H])C(C([H])([H])N([H])C(C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])N1C(C([H])=C([H])C1=O)=O)=O)=O)=O)=O)=O |
| Formula: | C49H51FN8O11 |
| M.Wt: | 946.9747 |
| Purity: | 98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |