| Cas No.: | 1450666-97-3 |
| Chemical Name: | MMV666810 |
| Synonyms: | Methanone, [4-[5-amino-6-[4-(trifluoromethyl)phenyl]-2-pyrazinyl]phenyl](4-hydroxy-1-piperidinyl)-;MMV666810 |
| SMILES: | C(C1=CC=C(C2=NC(C3=CC=C(C(F)(F)F)C=C3)=C(N)N=C2)C=C1)(N1CCC(O)CC1)=O |
| Formula: | C23H21F3N4O2 |
| M.Wt: | 442.43 |
| Purity: | 98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
