To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 3050683-38-7 |
| Chemical Name: | VAV1 degrader-3 |
| Synonyms: | 3050683-38-7;VAV1 degrader-3;EX-A11887 |
| SMILES: | ClC1C(=CC=CC=1C1C(NC(CC1)=O)=O)C1C=CC(=CC=1)N1C=CC=CC1=O |
| Formula: | C22H17ClN2O3 |
| M.Wt: | 392.83 |
| Purity: | 98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
