| Cas No.: | 2855085-25-3 |
| Chemical Name: | MS8815 |
| Synonyms: | MS8815;MS 8815 |
| SMILES: | N(C1CCOCC1)(C1C(C)=C(C(=O)NCC2C(=O)NC(C)=CC=2C)C=C(C2C=CC(CN3CCN(C(=O)CCCCCCCC(=O)N[C@@H](C(C)(C)C)C(N4C[C@H](O)C[C@H]4C(=O)NCC4C=CC(C5SC=NC=5C)=CC=4)=O)CC3)=CC=2)C=1)CC |
| Formula: | C65H87N9O8S |
| M.Wt: | 1154.50679516792 |
| Purity: | 98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
