| Cas No.: | 831243-31-3 |
| Chemical Name: | NAT |
| Synonyms: | AKOS003361537;CS-0434469;SR-01000296187-1;J7F;J7F;831243-31-3;831243-31-3;BDBM50604907;BDBM50604907;CHEMBL5198222;CHEMBL5198222;HY-144776;HY-144776;MS-24310;MS-24310;2-(2-~{tert}-butylphenoxy)-~{N}-(4-hydroxyphenyl)ethanamide;2-(2-~{tert}-butylphenoxy)-~{N}-(4-hydroxyphenyl)ethanamide;SR-01000296187;SR-01000296187;Acetamide, 2-[2-(1,1-dimethylethyl)phenoxy]-N-(4-hydroxyphenyl)- |
| SMILES: | O(CC(NC1C=CC(=CC=1)O)=O)C1C=CC=CC=1C(C)(C)C |
| Formula: | C18H21NO3 |
| M.Wt: | 299.364245176315 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
