| Cas No.: | 2154408-63-4 |
| Chemical Name: | NBI-921352 |
| Synonyms: | Benzenesulfonamide, 2-fluoro-5-methyl-4-[methyl[(3R)-1-(phenylmethyl)-3-pyrrolidinyl]amino]-N-4-thiazolyl-;XEN901 |
| SMILES: | C1(S(NC2=CSC=N2)(=O)=O)=CC(C)=C(N(C)[C@@H]2CCN(CC3=CC=CC=C3)C2)C=C1F |
| Formula: | C22H25FN4O2S2 |
| M.Wt: | 460.59 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Publication: | [1]. Jean-Christophe ANDREZ, et al. Benzenesulfonamide compounds and their use as therapeutic agents. Patent WO2017201468A1. |
| Description: | NBI-921352 is a Nav1.6 inhibitor with an IC50 value of 3.765 μM. |
| References: | [1]. Jean-Christophe ANDREZ, et al. Benzenesulfonamide compounds and their use as therapeutic agents. Patent WO2017201468A1. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
