| Cas No.: | 1228923-42-9 |
| Chemical Name: | NND-22111402 |
| Synonyms: | 14,19-Dioxa-5,7,27-triazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2,4,6(27),8,10,12(26),16,21,23-decaene, 11-[2-(1-pyrrolidinyl)ethoxy]-, 2-hydroxy-1,2,3-propanetricarboxylate (1:1) |
| SMILES: | C1CN(CCOC2=CC=C3N=C4N=CC=C(C5=CC=CC(COCC=CCOCC2=C3)=C5)N4)CC1.OC(=O)CC(O)(C(=O)O)CC(=O)O |t:10,24| |
| Formula: | C34H40N4O10 |
| M.Wt: | 664.70 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Pacritinib Citrate is the citrate salt form of pacritinib, an orally bioavailable inhibitor of Janus kinase 2 (JAK2). |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
