| Cas No.: | 2573775-59-2 |
| Chemical Name: | Cbl-b-IN-3 |
| Synonyms: | 1H-Isoindol-1-one, 2,3-dihydro-2-[3-[cis-3-methyl-1-(4-methyl-4H-1,2,4-triazol-3-yl)cyclobutyl]phenyl]-6-[[(3S)-3-methyl-1-piperidinyl]methyl]-4-(trifluoromethyl)-;Cbl-b-IN-3 |
| SMILES: | C1(=O)C2=C(C(C(F)(F)F)=CC(CN3CCC[C@H](C)C3)=C2)CN1C1=CC=CC([C@@]2(C3N(C)C=NN=3)C[C@H](C)C2)=C1 |
| Formula: | C30H34F3N5O |
| M.Wt: | 537.619077205658 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
