| Cas No.: | 1354805-08-5 |
| Chemical Name: | 4-[2-[8-[(4-Fluorophenyl)methyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-5-yl]-2-oxoethyl]bicyclo[2.2.1]heptane-1-carboxylic acid |
| Synonyms: | BDBM50542080;4-[2-[8-[(4-Fluorophenyl)methyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-5-;ONO-8430506 |
| SMILES: | FC1C=CC(=CC=1)CN1C2C(=CC=CN=2)C2=C1CN(CC2)C(CC12CCC(C(=O)O)(CC1)C2)=O |
| Formula: | C27H28FN3O3 |
| M.Wt: | 461.527930259705 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
