| Cas No.: | 357166-29-1 |
| Chemical Name: | Pemetrexed disodium heptahydrate |
| Synonyms: | LY231514; LY-231514; LY 231514; Pemetrexed, US brand name: ALIMTA. Abbreviation: MTA. |
| SMILES: | O=C(O[Na])CC[C@@H](C(O[Na])=O)NC(C1=CC=C(CCC2=CNC(N=C(N)N3)=C2C3=O)C=C1)=O.[7H2O] |
| Formula: | C20H33N5Na2O13 |
| M.Wt: | 875.37 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
