| Cas No.: | |
| Chemical Name: | Benzonitrile, 4-[(4S)-1,2,3,4,5,6,7,8-octahydro-7-methyl-2,5-dioxo-1-[3-(trifluoromethyl)phenyl]pyrimido[4,5-d]pyridazin-4-yl]- |
| Synonyms: | S-BAY-8040;S-BAY 8040;S-BAY8040 |
| SMILES: | C(C1C=CC([C@H]2NC(=O)N(C3C=C(C(F)(F)F)C=CC=3)C3=C2C(NN(C3)C)=O)=CC=1)#N |
| Formula: | C21H16F3N5O2 |
| M.Wt: | 427.38 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Publication: | 1. von Nussbaum F, et al. ChemMedChem. 2016 Jan 19;11(2):199-206. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
