| Cas No.: | 2756818-39-8 |
| Chemical Name: | SB-216 |
| Synonyms: | SB-216;Y5M;CHEMBL4855608;MS-24513;2756818-39-8;CS-0436217;HY-144898;SCHEMBL25415099;AKOS040758954;7-methoxy-4-(2-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)-3,4-dihydroquinoxalin-2(1H)-one;GLXC-26505 |
| SMILES: | O=C1NC2=CC(OC)=CC=C2N(C2N=C(C)N=C3CCCC=23)C1 |
| Formula: | C17H18N4O2 |
| M.Wt: | 310.35 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
