To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
.png)
| Cas No.: | 1656261-09-4 |
| Chemical Name: | SCO-267 |
| Synonyms: | SCO-267 |
| SMILES: | C(C1C=CC(OC)=CC=1N1CCC(COC2N=CC=C([C@H](C3CC3)CC(=O)O)C=2)CC1)(=O)N(C1=CC=CC(C)=N1)CC(C)(C)C |
| Formula: | C36H46N4O5 |
| M.Wt: | 614.77 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
