| Cas No.: | 667910-69-2 |
| Chemical Name: | Sirtuin modulator 2 |
| Synonyms: | BENZAMIDE, N-(3-IMIDAZO[2,1-B]THIAZOL-6-YLPHENYL)-2-METHOXY-;Benzamide, N-(3-imidazo[2,1-b]thiazol-6-ylphenyl)-2-methoxy-;N-(3-(imidazo[2,1-b]thiazol-6-yl)phenyl)-2-methoxybenzamide;Sirtuin modulator 2 |
| SMILES: | S1C=CN2C=C(C3C=CC=C(NC(=O)C4=CC=CC=C4OC)C=3)N=C12 |
| Formula: | C19H15N3O2S |
| M.Wt: | 349.406 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
