| Cas No.: | |
| Chemical Name: | SR18662 |
| Synonyms: | SR18662;SR-18662;SR 18662 |
| SMILES: | ClC1=CC(/C=C/C(NCC(N2CCN(CC2)S(C)(=O)=O)=O)=O)=CC=C1Cl |
| Formula: | C16H19Cl2N3O4S |
| M.Wt: | 420.31 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Publication: | [1]. Julie Kim,et al.The Novel Small-Molecule SR18662 Efficiently Inhibits the Growth of Colorectal Cancer In Vitroand In Vivo.Mol Cancer Ther.2019 Nov;18(11):1973-1984. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
