| Cas No.: | 186613-57-0 |
| Chemical Name: | 5-[[2-(Acetylamino)-3,4,6-tri-O-benzoyl-2-deoxy-β-D-galactopyranosyl]oxy]pentanoic acid |
| SMILES: | C1C=C(C=CC=1)C(=O)O[C@@H]1[C@@H](NC(=O)C)[C@H](OCCCCC(O)=O)O[C@H](COC(=O)C2C=CC=CC=2)[C@@H]1OC(=O)C1=CC=CC=C1 |
| Formula: | C34H35NO11 |
| M.Wt: | 633.64 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | TriGalNAc CBz is a GalNAc derivative and tri-GalNAc is an asialoglycoprotein receptor (ASGPR) ligand. TriGalNAc CBz can be used for mRNA drug delivery as well as lysosomal targeted chimerism (LYTAC) studies. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
