| Cas No.: | 2412461-98-2 |
| Chemical Name: | UR-MB108 |
| Synonyms: | 2-Quinolinecarboxamide, N-[5-[1-[4-[2-(3,4-dihydro-6,7-dimethoxy-2(1H)-isoquinolinyl)ethyl]phenyl]-1H-1,2,3-triazol-4-yl]-2-(1-oxopropyl)phenyl]- |
| SMILES: | N1C2C(=CC=CC=2)C=CC=1C(NC1=CC(C2=CN(C3=CC=C(CCN4CCC5=C(C4)C=C(OC)C(OC)=C5)C=C3)N=N2)=CC=C1C(=O)CC)=O |
| Formula: | C40H38N6O4 |
| M.Wt: | 666.767529010773 |
| Purity: | 98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
