| Cas No.: | 285978-18-9 |
| Chemical Name: | Uridine triphosphate 13C9,15N2 sodium |
| SMILES: | O[13C@H]([13C@@H]1O)[13C@@]([15N]([13CH]=[13CH][13C]2=O)[13C]([15NH]2)=O)([H])O[13C@@H]1[13CH2]O[P](O[P](O[P]([O-])([O-])=O)(O)=O)(O)=O.[Na+].[Na+] |
| Formula: | 13C9H1315N2Na2O15P3 |
| M.Wt: | 539.03 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
