| Cas No.: | 863971-56-6 |
| Chemical Name: | Val-Cit-PAB-MMAF |
| Synonyms: | L-Phenylalanine, N-methyl-N-[[[4-[[L-valyl-N5-(aminocarbonyl)-L-ornithyl]amino]phenyl]methoxy]carbonyl]-L-valyl-L-valyl-(3R,4S,5S)-3-methoxy-5-methyl-4-(methylamino)heptanoyl-(αR,βR,2S)-β-methoxy-α-methyl-2-pyrrolidinepropanoyl- |
| SMILES: | [C@@H]([C@]1([H])CCCN1C(=O)C[C@@H](OC)[C@]([H])([C@@H](C)CC)N(C)C(=O)[C@H](C(C)C)NC(=O)[C@H](C(C)C)N(C)C(=O)OCC1C=CC(NC(=O)[C@H](CCCNC(=O)N)NC(=O)[C@@H](N)C(C)C)=CC=1)(OC)[C@@H](C)C(=O)N[C@H](C(=O)O)CC1C=CC=CC=1 |
| Formula: | C58H92N10O13 |
| M.Wt: | 1137.41 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Val-Cit-PAB-MMAF is a drug-linker conjugate for ADC. Val-Cit-PAB-MMAF contains the ADCs linker (peptide Val-Cit-PAB) and a potent tubulin polymerization inhibitor MMAF. |
| Target: | Auristatin |
| References: | [1]. Svetlana Doronina, et al. Monomethylvaline compounds capable of conjugation to ligands. US20050238649A1. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
