| Cas No.: | 2374124-49-7 |
| Chemical Name: | NND-2281604 |
| Synonyms: | 13H-17,20-Methano-8,12-nitrilo-12H-pyrido[3,2-d][1,2,6,13]thiatriazacyclooctadecin-5(6H)-one, 2-[3-(2-dispiro[2.0.2.1]hept-7-ylethoxy)-1H-pyrazol-1-yl]-14,15,16,17,18,19-hexahydro-19,19-dimethyl-, 7,7-dioxide, (17S)- |
| SMILES: | S1(=O)(=O)C2N3N1C(=O)C1=CC=C(N4C=CC(OCCC5C6(CC6)C65CC6)=N4)N=C1N1C[C@@]([H])(CCCNC3C=CC=2)CC1(C)C |
| Formula: | C32H39N7O4S |
| M.Wt: | 617.76 |
| Purity: | 98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
