| Cas No.: | 2417718-25-1 |
| Chemical Name: | 2-Naphthalenecarboxamide, N-[(1S)-1-(2-pyridinyl)ethyl]-5-[4-(trifluoromethyl)phenyl]- |
| Synonyms: | 2-Naphthalenecarboxamide, N-[(1S)-1-(2-pyridinyl)ethyl]-5-[4-(trifluoromethyl)phenyl]-;VT-104;VT104 |
| SMILES: | C1=C2C(C(C3=CC=C(C(F)(F)F)C=C3)=CC=C2)=CC=C1C(N[C@H](C1=NC=CC=C1)C)=O |
| Formula: | C25H19F3N2O |
| M.Wt: | 420.426376581192 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
