| Cas No.: | 17680-99-8 |
| Chemical Name: | b-D-Glucopyranosiduronic acid,4-methylphenyl |
| Synonyms: | b-D-Glucopyranosiduronic acid,4-methylphenyl;P-TOLYL-BETA-D-GLUCURONIDE;(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(4-methylphenoxy)oxane-2-carboxylic acid;4-Methylphenol glucuronide;A-D-glucuronic acid;A-D-glucuronide;p-methylphenyl glucuronide;p-Tolyl-;p-Cresol Glucuronide;p-Tolyl-β-D-glucuronide;p-Tolyl-β-D-glucuronic acid |
| SMILES: | CC1C=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O)=CC=1 |
| Formula: | C13H16O7 |
| M.Wt: | 284.26194 |
| Sotrage: | -20 |
| Publication: | 1. Rong, Y., and Kiang, T.K.L. Characterizations of human UDP-glucuronosyltransferase enzymes in the conjugation of p-cresol. Toxicol. Sci. 176(2), 285-296 (2020). 2. Gryp, T., De Paepe, K., Vanholder, R., et al. Gut microbiota generation of protein-boun |
| Description: | p-Cresol glucuronide is a metabolite of p-cresol, a uremic toxin formed by bacterial fermentation of proteins in the large intestine. It is formed from p-cresol primarily by the UDP-glucuronosyltransferase (UGT) isoform UGT1A6, but also by UGT1A9, in human liver and kidney microsomes. p-Cresol glucuronide accumulates in feces, blood, and urine of patients with chronic kidney disease (CKD). |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
