| Cas No.: | 2097971-11-2 |
| Chemical Name: | (S,R,S)-AHPC-PEG3-NH2 hydrochloride(E3 ligase Ligand-Linker Conjugates 5) |
| SMILES: | O=C([C@H]1N(C([C@H](C(C)(C)C)NC(COCCOCCOCCN)=O)=O)C[C@H](O)C1)NCC2=CC=C(C3=C(C)N=CS3)C=C2.[H]Cl |
| Formula: | C30H46ClN5O7S |
| M.Wt: | 656.23 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
