| Cas No.: | 2226547-25-5 |
| Chemical Name: | Lipid 8 |
| Synonyms: | 2-[Di-(9Z,12Z)-9,12-octadecadien-1-ylamino]ethyl 4-(dimethylamino)butanoate;Lipid-8,Lipid8 |
| SMILES: | CCCCC/C=C\C/C=C\CCCCCCCCN(CCOC(=O)CCCN(C)C)CCCCCCCC/C=C\C/C=C\CCCCC |
| Formula: | C44H82N2O2 |
| M.Wt: | 671.13 |
| Purity: | ELSD-HPLC>95% |
| Sotrage: | 1 year -20°C |
| Publication: | Dual-Targeted Lipid Nanotherapeutic Boost for Chemo-Immunotherapy of Cancer-Adv. Mater. 2022, 34, 2106350 |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
