To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 59-66-5 |
| SMILES: | CC(NC1=NN=C(S(=O)(N)=O)S1)=O |
| Formula: | C4H6N4O3S2 |
| M.Wt: | 222.25 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Acetazolamide is a potent carbonic anhydrase (CA) inhibitor; best-studied agent for the amelioration of acute mountain sickness (AMS). |
