To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 22560-50-5 |
| Chemical Name: | sodium (dichloromethylene)bis(hydrogenphosphonate) |
| Synonyms: | Clodronate sodium; clodronic acid disodium salt; disodium dichloromethylene diphosphonate; Dichloromethylenediphosphonic acid disodium salt. Foreign brand names: Bonefos; Clasteon; Difosfonal; Loron; Mebonat; Ossiten. Code name: CL2MDP; DMDP. |
| SMILES: | O=P(C(Cl)(Cl)P(O)(O[Na])=O)(O)O[Na] |
| Formula: | CH2Cl2Na2O6P2 |
| M.Wt: | 288.86 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
