To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 80321-63-7 |
| Synonyms: | N/A |
| SMILES: | O[C@H]1[C@H](O)[C@@H](CO)O[C@@H](O[C@@H]2C(C)(C)[C@@](CC[C@]3(C)[C@]4([H])C[C@@H](O)[C@@]5([H])[C@@]3(C)CC[C@@H]5[C@](O[C@@H]6O[C@H](CO[C@@H]7OC[C@@H](O)[C@H](O)[C@H]7O)[C@@H](O)[C@H](O)[C@H]6O)(C)CC/C=C(C)C)([H])[C@]4(C)CC2)[C@@H]1O |
| Formula: | C48H82O18 |
| M.Wt: | 917.13 |
| Purity: | >99% |
| Sotrage: | 2 years -20°C Powder, 2 weeks4°C in DMSO,6 months-80°C in DMSO |
| Description: | For the detailed information of Gynostemma Extract, the solubility of Gynostemma Extract in water, the solubility of Gynostemma Extract in DMSO, the solubility of Gynostemma Extract in PBS buffer, the animal experiment（test） (test) of Gynostemma Extract, |