To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 78-44-4 |
| SMILES: | CC(NC(OCC(COC(=O)N)(C)CCC)=O)C |
| Formula: | C12H24N2O4 |
| M.Wt: | 260.33 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Carisoprodol is a centrally acting skeletal muscle relaxant of the carbamate class and produces all the effects associated with barbiturate receptor ligands. |
