| Cas No.: | 17321-77-6 |
| Chemical Name: | 3-(3-chloro-10,11-dihydro-5H-dibenzo[b,f]azepin-5-yl)-N,N-dimethylpropan-1-amine hydrochloride |
| Synonyms: | Anafranil; Clomicalm; G-34586; G34586; G 34586; Hydiphen |
| SMILES: | Cl.CN(CCCN1C2C=CC=CC=2CCC2C=CC(=CC1=2)Cl)C |
| Formula: | C19H24Cl2N2 |
| M.Wt: | 351.31 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Clomipramine HCl is a serotonin transporter (SERT), norepinephrine transporter (NET) dopamine transporter (DAT) blocker with Ki of 0.14, 54 and 3 nM, respectively.Clomipramine hydrochloride (Anafranil) is a hydrochloride salt of clomipramine which is a serotonin transporter (SERT), norepinephrine transporter (NET) dopamine transporter (DAT) blocker with Ki of 0.14, 54 and 3 nM, respectively. Clomipramine hydrochloride (Anafranil) is a tricyclic antidepressant. Clomipramine hydrochloride (Anafranil) is a norepinephrine-reuptake inhibitor and is an antiobsessional drug. Clomipramine hydrochloride (Anafranil) is an antagonist/inverse agonist at the following receptors: D2 receptor (Ki = 162 nM), D3 receptor (Ki = 30 nM), α1-adrenergic receptor (Ki = 3.2 nM), α2-adrenergic receptor (Ki = 525 nM), H1 receptor (Ki = 31 nM), mACh receptors (Ki = 37 nM), 5-HT2A receptor (Ki = 36 nM), 5-HT2C receptor (Ki = 65 nM), 5-HT3 receptor (Ki = 85 nM), 5-HT6 receptor (Ki = 54 nM), 5-HT7 receptor (Ki = 127 nM), D1 receptor (Ki = 219 nM). |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
