| Cas No.: | 1639358-50-1 |
| Chemical Name: | tert-butyl 2-(4-(tert-butoxycarbonyloxy)phenyl)cyclopropylcarbamate |
| Synonyms: | CBB-3001;CBB 3001 |
| SMILES: | C(OC(C)(C)C)(=O)NC1CC1C1=CC=C(OC(OC(C)(C)C)=O)C=C1 |
| Formula: | C19H27NO5 |
| M.Wt: | 349.427 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | CBB3001 (CBB-3001) is a novel potent, selective histone demethylase LSD1 inhibitor with IC50 of 21.25 uM; potently inhibits LSD1 activity both in vitro and in vivo; CBB3001 also selectively inhibits the growth of human ovarian teratocarcinoma PA-1 and mouse embryonic carcinoma F9 cells, caused the downregulation of pluripotent stem cell proteins SOX2 and OCT4, does not have significant inhibition on the growth of human colorectal carcinoma HCT116 cells or mouse fibroblast NIH3T3 cells that do not express these stem cell proteins. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
