| Cas No.: | 1422620-34-5 |
| Chemical Name: | N-(4-((1S,2R)-2-((cyclopropylmethyl)amino)cyclopropyl)phenyl)-1-methyl-1H-pyrazole-4-carboxamide |
| Synonyms: | T 3775440;T3775440 |
| SMILES: | N(C)1C=C(C(NC2=CC=C([C@H]3C[C@@H]3NCC3CC3)C=C2)=O)C=N1 |
| Formula: | C18H22N4O |
| M.Wt: | 310.401 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | T-3775440 is a novel potent, selecitve, irreversible LSD1 inhibitor with IC50 of 2.1 nM; displays high selectivity for LSD1 relative to other monoamine oxidases (e.g., MAO-A and MAO-B); disrupts the interaction between LSD1 and growth factor-independent 1B (GFI1B) in leukemia cell lines, exhibites significant antitumor efficacy in AEL and AMKL xenograft models. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
