| Cas No.: | 7134-19-2 |
| Chemical Name: | Methyl-N-[(4-chlorophenyl)sulfonyl]-4-nitrobenzenesulfinimidoate |
| Synonyms: | CCG 4986;CCG4986 |
| SMILES: | C(S(=NS(C1=CC=C(Cl)C=C1)(=O)=O)OC)1=CC=C([N+]([O-])=O)C=C1 |
| Formula: | C13H11ClN2O5S2 |
| M.Wt: | 374.81 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A non-peptide, selective RGS4 inhibitor that inhibits RGS4/Gα(o) binding with 3 to 5 uM potency; shows selectivity for RGS4 and does not inhibit RGS8; binds to RGS4, inhibits RGS4 stimulation of Galpha(o) GTPase activity in vitro, and prevents RGS4 regulation of mu-opioid-inhibited adenylyl cyclase activity in permeabilized cells. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
