| Cas No.: | 75593-17-8 |
| Chemical Name: | (4Z)-4-(2-amino-1,5-dihydro-5-oxo-4H-imidazol-4-ylidene)-4,5,6,7-tetrahydro-pyrrolo[2,3-c]azepin-8(1H)-one |
| Synonyms: | SKF-108753;SKF108753 |
| SMILES: | N1CC/C(=C2\C(=O)NC(N)=N\2)/C2C=CNC=2C1=O |
| Formula: | C11H11N5O2 |
| M.Wt: | 245.2 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A marine sponge alkaloid that inhibits Chk1 and Chk2 with IC50 of 3 and 3.5 uM, respectively; also inhibits MAP kinase kinase 1 (IC50=881 nM), GSK3β (IC50=1.39 uM), and CDK5/p25 (IC50=9.12 uM), does not significantly affect ATM and ATR; blocks G2 arrest in cancer cells. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
