| Cas No.: | 1200126-26-6 |
| Chemical Name: | 3-(4-(piperidin-1-ylmethyl)phenyl)-9H-pyrrolo[2,3-b:5,4-c']dipyridine-6-carbonitrile |
| Synonyms: | GNE 900;GNE900 |
| SMILES: | C12NC3C(C1=CC(C1=CC=C(CN4CCCCC4)C=C1)=CN=2)=CC(C#N)=NC=3 |
| Formula: | C23H21N5 |
| M.Wt: | 367.45 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | GNE-900 (GNE900) is a potent, selective, ATP-competitive, and orally bioavailable Chk1 inhibitor with IC50 of <1 nM; displays >300-fold selectivity over Aurora, PLK, CDK1/2) and ChK2; abrogates DNA damage-induced S and G2–M checkpoints (EC50=61.8 nM in H-29 cells), and exacerbates DNA double-strand breaks (DSB) to induce cell death, accelerates the demise of damaged HCT-116 colorectal cancer cells in a p53-dependent manner in vitro; potentiates the efficacy of gemcitabine in tumor xenografts. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
