| Cas No.: | |
| Chemical Name: | 7-nitro-1H-indole-2-carboxylic acid {4-[1-(guanidinohydrazone)-ethyl]-phenyl}-amide |
| Synonyms: | NSC-744039;NSC744039;PV1019 |
| SMILES: | N1C2=C(C=CC=C2[N+]([O-])=O)C=C1C(NC1=CC=C(/C(=N/NNC(N)=N)/C)C=C1)=O |
| Formula: | C18H17N7O3 |
| M.Wt: | 379.38 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A potent, ATP-competitive and highly selective Chk2 inhibitor with IC50 of 138 nM; displays much reduced or no activity against a panel of 52 other cellular kinases, including Chk1; inhibits Chk2-mediated phosphorylation of Cdc25C (IC50=260 nM), and nd HDMX degradation in response to DNA damage; protects normal mouse thymocytes against ionizing radiation-induced apoptosis. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
