| Cas No.: | 2055468-48-7 |
| Chemical Name: | (R)-2-hydroxy-2-(4-iodophenethyl)succinic acid |
| Synonyms: | PF 06678419;PF06678419 |
| SMILES: | C(O)(=O)[C@](O)(CCC1=CC=C(I)C=C1)CC(O)=O |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | PF-06678419 (PF06678419) is a potent, selective inhibitor of the Na+/citrate transporter NaCT (SLC13A5) that shows inhibition of citrate uptake in the HEKNaCT cells with IC50 of 0.44 uM; displays relatively selectivity over NaDC1 and NaDC3 (7-10-fold). |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
